C9H17AsO3 — CID 173146696
1-dimethylarsanyl-4,4-dimethoxypent-1-en-3-one (PubChem CID 173146696) has the molecular formula C9H17AsO3 and a molecular weight of 248.15 g/mol. Its IUPAC name is 1-dimethylarsanyl-4,4-dimethoxypent-1-en-3-one.
| Compound Name | 1-dimethylarsanyl-4,4-dimethoxypent-1-en-3-one |
|---|---|
| PubChem CID | 173146696 |
| Molecular Formula | C9H17AsO3 |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-dimethylarsanyl-4,4-dimethoxypent-1-en-3-one |
| SMILES | COC(C)(OC)C(=O)C=C[As](C)C |
| InChI | InChI=1S/C9H17AsO3/c1-9(12-4,13-5)8(11)6-7-10(2)3/h6-7H,1-5H3 |
| InChIKey | PWQXVTPGUFDDQS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|