C14H17N3S — CID 173148055
4-(4-methylpiperazin-1-yl)-3-phenyl-1,2-thiazole (PubChem CID 173148055) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-3-phenyl-1,2-thiazole.
| Compound Name | 4-(4-methylpiperazin-1-yl)-3-phenyl-1,2-thiazole |
|---|---|
| PubChem CID | 173148055 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-3-phenyl-1,2-thiazole |
| SMILES | CN1CCN(c2csnc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C14H17N3S/c1-16-7-9-17(10-8-16)13-11-18-15-14(13)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3 |
| InChIKey | GYSDLQDQEVZQOO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |