About sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate
sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate (PubChem CID 173148835) has the molecular formula C4H13N2NaO7P2
and a molecular weight of 286.09 g/mol. Its IUPAC name is sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate.
Molecular Properties
| Compound Name | sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate |
| PubChem CID | 173148835 |
| Molecular Formula | C4H13N2NaO7P2 |
| Molecular Weight | 286.09 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)ON1CCNCC1.[H-].[Na+] |
| InChI | InChI=1S/C4H12N2O7P2.Na.H/c7-14(8,9)13-15(10,11)12-6-3-1-5-2-4-6;;/h5H,1-4H2,(H,10,11)(H2,7,8,9);;/q;+1;-1 |
| InChIKey | XGDQDVBRLRPYPM-UHFFFAOYSA-N |
| XLogP | -3.85 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.09 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate?
The IUPAC name of sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate (CID 173148835) is sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate.
What is the SMILES notation for sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate?
The canonical SMILES for sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate is O=P(O)(O)OP(=O)(O)ON1CCNCC1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate?
The InChIKey is XGDQDVBRLRPYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2O7P2.Na.H/c7-14(8,9)13-15(10,11)12-6-3-1-5-2-4-6;;/h5H,1-4H2,(H,10,11)(H2,7,8,9);;/q;+1;-1.
What are the key properties of sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate?
sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate has a molecular weight of 286.09 g/mol, XLogP of -3.85, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phosphono piperazin-1-yl hydrogen phosphate is sourced from PubChem (CID 173148835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).