About dipiperazin-1-yl oxalate
dipiperazin-1-yl oxalate (PubChem CID 57296724) has the molecular formula C10H18N4O4
and a molecular weight of 258.28 g/mol. Its IUPAC name is dipiperazin-1-yl oxalate.
Molecular Properties
| Compound Name | dipiperazin-1-yl oxalate |
| PubChem CID | 57296724 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | dipiperazin-1-yl oxalate |
| SMILES | O=C(ON1CCNCC1)C(=O)ON1CCNCC1 |
| InChI | InChI=1S/C10H18N4O4/c15-9(17-13-5-1-11-2-6-13)10(16)18-14-7-3-12-4-8-14/h11-12H,1-8H2 |
| InChIKey | OYGYUWRGZOUMIH-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze dipiperazin-1-yl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipiperazin-1-yl oxalate?
The IUPAC name of dipiperazin-1-yl oxalate (CID 57296724) is dipiperazin-1-yl oxalate.
What is the SMILES notation for dipiperazin-1-yl oxalate?
The canonical SMILES for dipiperazin-1-yl oxalate is O=C(ON1CCNCC1)C(=O)ON1CCNCC1.
What is the InChIKey of dipiperazin-1-yl oxalate?
The InChIKey is OYGYUWRGZOUMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O4/c15-9(17-13-5-1-11-2-6-13)10(16)18-14-7-3-12-4-8-14/h11-12H,1-8H2.
What are the key properties of dipiperazin-1-yl oxalate?
dipiperazin-1-yl oxalate has a molecular weight of 258.28 g/mol, XLogP of -2.29, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dipiperazin-1-yl oxalate is sourced from PubChem (CID 57296724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).