C27H27N3O4 — CID 173151297
N-[[1-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-phenylbutyl]carbamoyl]benzamide (PubChem CID 173151297) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[[1-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-phenylbutyl]carbamoyl]benzamide.
| Compound Name | N-[[1-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-phenylbutyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 173151297 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[[1-[4-[3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-4-phenylbutyl]carbamoyl]benzamide |
| SMILES | O=C(C=Cc1ccc(C(CCCc2ccccc2)NC(=O)NC(=O)c2ccccc2)cc1)NO |
| InChI | InChI=1S/C27H27N3O4/c31-25(30-34)19-16-21-14-17-22(18-15-21)24(13-7-10-20-8-3-1-4-9-20)28-27(33)29-26(32)23-11-5-2-6-12-23/h1-6,8-9,11-12,14-19,24,34H,7,10,13H2,(H,30,31)(H2,28,29,32,33) |
| InChIKey | PPZNLNZBFNQOFD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|