C25H25NO4 — CID 10408871
(E)-N-hydroxy-3-[4-[1-methoxy-2-(4-phenylmethoxyphenyl)ethyl]phenyl]prop-2-enamide (PubChem CID 10408871) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[1-methoxy-2-(4-phenylmethoxyphenyl)ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[1-methoxy-2-(4-phenylmethoxyphenyl)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10408871 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[1-methoxy-2-(4-phenylmethoxyphenyl)ethyl]phenyl]prop-2-enamide |
| SMILES | COC(Cc1ccc(OCc2ccccc2)cc1)c1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C25H25NO4/c1-29-24(22-12-7-19(8-13-22)11-16-25(27)26-28)17-20-9-14-23(15-10-20)30-18-21-5-3-2-4-6-21/h2-16,24,28H,17-18H2,1H3,(H,26,27)/b16-11+ |
| InChIKey | QVBKNSLDVAHHFG-LFIBNONCSA-N |
| XLogP | 4.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|