C26H24BrNO4 — CID 68667164
methyl (2S)-2-[[(E)-3-(3-bromophenyl)prop-2-enoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 68667164) has the molecular formula C26H24BrNO4 and a molecular weight of 494.39 g/mol. Its IUPAC name is methyl (2S)-2-[[(E)-3-(3-bromophenyl)prop-2-enoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(E)-3-(3-bromophenyl)prop-2-enoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 68667164 |
| Molecular Formula | C26H24BrNO4 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | methyl (2S)-2-[[(E)-3-(3-bromophenyl)prop-2-enoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C26H24BrNO4/c1-31-26(30)24(28-25(29)15-12-19-8-5-9-22(27)16-19)17-20-10-13-23(14-11-20)32-18-21-6-3-2-4-7-21/h2-16,24H,17-18H2,1H3,(H,28,29)/b15-12+/t24-/m0/s1 |
| InChIKey | HRGBAMRULIFZIQ-ZHSJKAEUSA-N |
| XLogP | 4.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|