C30H28N2O5 — CID 156757058
methyl (2S)-2-[[(E)-3-[4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 156757058) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is methyl (2S)-2-[[(E)-3-[4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(E)-3-[4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 156757058 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | methyl (2S)-2-[[(E)-3-[4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)/C=C/c1ccc(OCc2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C30H28N2O5/c1-21-26(29(32-37-21)24-11-7-4-8-12-24)20-36-25-16-13-22(14-17-25)15-18-28(33)31-27(30(34)35-2)19-23-9-5-3-6-10-23/h3-18,27H,19-20H2,1-2H3,(H,31,33)/b18-15+/t27-/m0/s1 |
| InChIKey | MDDPSLOINOPZRC-QSRNJPNHSA-N |
| XLogP | 5.14 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|