C22H20N2O4 — CID 155552111
3-cyanopropyl 4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]benzoate (PubChem CID 155552111) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-cyanopropyl 4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]benzoate.
| Compound Name | 3-cyanopropyl 4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 155552111 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-cyanopropyl 4-[(5-methyl-3-phenyl-1,2-oxazol-4-yl)methoxy]benzoate |
| SMILES | Cc1onc(-c2ccccc2)c1COc1ccc(C(=O)OCCCC#N)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-16-20(21(24-28-16)17-7-3-2-4-8-17)15-27-19-11-9-18(10-12-19)22(25)26-14-6-5-13-23/h2-4,7-12H,5-6,14-15H2,1H3 |
| InChIKey | JWWFYHFSBIPDKO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|