C24H29NO4 — CID 68883684
4-[[4-[3-(2-ethoxyethoxy)propyl]phenoxy]methyl]-5-methyl-3-phenyl-1,2-oxazole (PubChem CID 68883684) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-[[4-[3-(2-ethoxyethoxy)propyl]phenoxy]methyl]-5-methyl-3-phenyl-1,2-oxazole.
| Compound Name | 4-[[4-[3-(2-ethoxyethoxy)propyl]phenoxy]methyl]-5-methyl-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 68883684 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[[4-[3-(2-ethoxyethoxy)propyl]phenoxy]methyl]-5-methyl-3-phenyl-1,2-oxazole |
| SMILES | CCOCCOCCCc1ccc(OCc2c(-c3ccccc3)noc2C)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-3-26-16-17-27-15-7-8-20-11-13-22(14-12-20)28-18-23-19(2)29-25-24(23)21-9-5-4-6-10-21/h4-6,9-14H,3,7-8,15-18H2,1-2H3 |
| InChIKey | JOEAZOUYKFUFPF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|