C31H27F4NO5 — CID 173151501
6-[5-fluoro-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-(2,3,5-trifluoro-4-methylphenoxy)hex-5-enoic acid (PubChem CID 173151501) has the molecular formula C31H27F4NO5 and a molecular weight of 569.55 g/mol. Its IUPAC name is 6-[5-fluoro-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-(2,3,5-trifluoro-4-methylphenoxy)hex-5-enoic acid.
| Compound Name | 6-[5-fluoro-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-(2,3,5-trifluoro-4-methylphenoxy)hex-5-enoic acid |
|---|---|
| PubChem CID | 173151501 |
| Molecular Formula | C31H27F4NO5 |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 6-[5-fluoro-2-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-(2,3,5-trifluoro-4-methylphenoxy)hex-5-enoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(F)cc1C=CCCC(Oc1cc(F)c(C)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C31H27F4NO5/c1-18-23(33)17-27(29(35)28(18)34)41-26(31(37)38)11-7-6-10-21-16-22(32)12-13-25(21)39-15-14-24-19(2)40-30(36-24)20-8-4-3-5-9-20/h3-6,8-10,12-13,16-17,26H,7,11,14-15H2,1-2H3,(H,37,38) |
| InChIKey | OWGMIJLPQCZPJR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|