C23H28FNO9P2 — CID 87962376
[diethoxyphosphoryloxy-[3-fluoro-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]phosphonic acid (PubChem CID 87962376) has the molecular formula C23H28FNO9P2 and a molecular weight of 543.42 g/mol. Its IUPAC name is [diethoxyphosphoryloxy-[3-fluoro-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]phosphonic acid.
| Compound Name | [diethoxyphosphoryloxy-[3-fluoro-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 87962376 |
| Molecular Formula | C23H28FNO9P2 |
| Molecular Weight | 543.42 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | [diethoxyphosphoryloxy-[3-fluoro-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]phosphonic acid |
| SMILES | CCOP(=O)(OCC)OC(c1ccc(OCCc2nc(-c3ccccc3)oc2C)c(F)c1)P(=O)(O)O |
| InChI | InChI=1S/C23H28FNO9P2/c1-4-31-36(29,32-5-2)34-23(35(26,27)28)18-11-12-21(19(24)15-18)30-14-13-20-16(3)33-22(25-20)17-9-7-6-8-10-17/h6-12,15,23H,4-5,13-14H2,1-3H3,(H2,26,27,28) |
| InChIKey | ASIRPPRBJQCJGL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|