C64H73N2S+ — CID 173151805
[5-(4-butyl-N-(3-butylphenyl)anilino)-2-[(E)-2-[4-[(E)-2-[4-(4-butyl-N-(4-butylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-dimethylsulfanium (PubChem CID 173151805) has the molecular formula C64H73N2S+ and a molecular weight of 902.37 g/mol. Its IUPAC name is [5-(4-butyl-N-(3-butylphenyl)anilino)-2-[(E)-2-[4-[(E)-2-[4-(4-butyl-N-(4-butylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-dimethylsulfanium.
| Compound Name | [5-(4-butyl-N-(3-butylphenyl)anilino)-2-[(E)-2-[4-[(E)-2-[4-(4-butyl-N-(4-butylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-dimethylsulfanium |
|---|---|
| PubChem CID | 173151805 |
| Molecular Formula | C64H73N2S+ |
| Molecular Weight | 902.37 g/mol |
| Exact Mass | 901.55 |
| IUPAC Name | [5-(4-butyl-N-(3-butylphenyl)anilino)-2-[(E)-2-[4-[(E)-2-[4-(4-butyl-N-(4-butylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-dimethylsulfanium |
| SMILES | CCCCc1ccc(N(c2ccc(/C=C/c3ccc(/C=C/c4ccc(N(c5ccc(CCCC)cc5)c5cccc(CCCC)c5)cc4[S+](C)C)cc3)cc2)c2ccc(CCCC)cc2)cc1 |
| InChI | InChI=1S/C64H73N2S/c1-7-11-16-50-29-39-58(40-30-50)65(59-41-31-51(32-42-59)17-12-8-2)60-45-35-55(36-46-60)27-24-53-22-25-54(26-23-53)28-37-57-38-47-63(49-64(57)67(5)6)66(61-43-33-52(34-44-61)18-13-9-3)62-21-15-20-56(48-62)19-14-10-4/h15,20-49H,7-14,16-19H2,1-6H3/q+1/b27-24+,37-28+ |
| InChIKey | FRHYPOYVRDANRS-GSNIHLSGSA-N |
| XLogP | 18.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.37 |
| LogP ≤ 5 | 18.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|