C25H34N2O — CID 173154633
1-(3-methylbutyl)-N-[[4-(3-methylphenyl)phenyl]methyl]piperidine-2-carboxamide (PubChem CID 173154633) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-(3-methylbutyl)-N-[[4-(3-methylphenyl)phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | 1-(3-methylbutyl)-N-[[4-(3-methylphenyl)phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 173154633 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-(3-methylbutyl)-N-[[4-(3-methylphenyl)phenyl]methyl]piperidine-2-carboxamide |
| SMILES | Cc1cccc(-c2ccc(CNC(=O)C3CCCCN3CCC(C)C)cc2)c1 |
| InChI | InChI=1S/C25H34N2O/c1-19(2)14-16-27-15-5-4-9-24(27)25(28)26-18-21-10-12-22(13-11-21)23-8-6-7-20(3)17-23/h6-8,10-13,17,19,24H,4-5,9,14-16,18H2,1-3H3,(H,26,28) |
| InChIKey | JRZMUEPIJAWQPD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |