C27H34F3N3O — CID 173155729
2-[4-[2-(3-octyl-1,2,4-oxadiazol-5-yl)ethyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethanamine (PubChem CID 173155729) has the molecular formula C27H34F3N3O and a molecular weight of 473.58 g/mol. Its IUPAC name is 2-[4-[2-(3-octyl-1,2,4-oxadiazol-5-yl)ethyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-[4-[2-(3-octyl-1,2,4-oxadiazol-5-yl)ethyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 173155729 |
| Molecular Formula | C27H34F3N3O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 2-[4-[2-(3-octyl-1,2,4-oxadiazol-5-yl)ethyl]phenyl]-1-[4-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CCCCCCCCc1noc(CCc2ccc(CC(N)c3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C27H34F3N3O/c1-2-3-4-5-6-7-8-25-32-26(34-33-25)18-13-20-9-11-21(12-10-20)19-24(31)22-14-16-23(17-15-22)27(28,29)30/h9-12,14-17,24H,2-8,13,18-19,31H2,1H3 |
| InChIKey | ZZAOGFRQWVCRLQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|