C18H40IP — CID 173157800
5,6-dibutyldecan-5-ylphosphane;hydroiodide (PubChem CID 173157800) has the molecular formula C18H40IP and a molecular weight of 414.40 g/mol. Its IUPAC name is 5,6-dibutyldecan-5-ylphosphane;hydroiodide.
| Compound Name | 5,6-dibutyldecan-5-ylphosphane;hydroiodide |
|---|---|
| PubChem CID | 173157800 |
| Molecular Formula | C18H40IP |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 5,6-dibutyldecan-5-ylphosphane;hydroiodide |
| SMILES | CCCCC(CCCC)C(P)(CCCC)CCCC.I |
| InChI | InChI=1S/C18H39P.HI/c1-5-9-13-17(14-10-6-2)18(19,15-11-7-3)16-12-8-4;/h17H,5-16,19H2,1-4H3;1H |
| InChIKey | VXMHFZHXWBZSJQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|