C26H56BrP — CID 173157930
7,8-dihexyltetradecan-7-ylphosphane;hydrobromide (PubChem CID 173157930) has the molecular formula C26H56BrP and a molecular weight of 479.61 g/mol. Its IUPAC name is 7,8-dihexyltetradecan-7-ylphosphane;hydrobromide.
| Compound Name | 7,8-dihexyltetradecan-7-ylphosphane;hydrobromide |
|---|---|
| PubChem CID | 173157930 |
| Molecular Formula | C26H56BrP |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 7,8-dihexyltetradecan-7-ylphosphane;hydrobromide |
| SMILES | Br.CCCCCCC(CCCCCC)C(P)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C26H55P.BrH/c1-5-9-13-17-21-25(22-18-14-10-6-2)26(27,23-19-15-11-7-3)24-20-16-12-8-4;/h25H,5-24,27H2,1-4H3;1H |
| InChIKey | RCOZGFQQUMMMAN-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|