C19H28N2O6S2 — CID 173158622
4-methyl-N-[(4S)-1-(2-methylsulfonylphenyl)sulfonyl-3-oxoazepan-4-yl]pentanamide (PubChem CID 173158622) has the molecular formula C19H28N2O6S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-methyl-N-[(4S)-1-(2-methylsulfonylphenyl)sulfonyl-3-oxoazepan-4-yl]pentanamide.
| Compound Name | 4-methyl-N-[(4S)-1-(2-methylsulfonylphenyl)sulfonyl-3-oxoazepan-4-yl]pentanamide |
|---|---|
| PubChem CID | 173158622 |
| Molecular Formula | C19H28N2O6S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 4-methyl-N-[(4S)-1-(2-methylsulfonylphenyl)sulfonyl-3-oxoazepan-4-yl]pentanamide |
| SMILES | CC(C)CCC(=O)N[C@H]1CCCN(S(=O)(=O)c2ccccc2S(C)(=O)=O)CC1=O |
| InChI | InChI=1S/C19H28N2O6S2/c1-14(2)10-11-19(23)20-15-7-6-12-21(13-16(15)22)29(26,27)18-9-5-4-8-17(18)28(3,24)25/h4-5,8-9,14-15H,6-7,10-13H2,1-3H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | JJCWIDDNPWCKLT-HNNXBMFYSA-N |
| XLogP | 1.36 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |