C18H19NO2 — CID 173159216
N-[5-(3-methoxyphenyl)-3,3-dimethyl-2H-inden-1-ylidene]hydroxylamine (PubChem CID 173159216) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[5-(3-methoxyphenyl)-3,3-dimethyl-2H-inden-1-ylidene]hydroxylamine.
| Compound Name | N-[5-(3-methoxyphenyl)-3,3-dimethyl-2H-inden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 173159216 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[5-(3-methoxyphenyl)-3,3-dimethyl-2H-inden-1-ylidene]hydroxylamine |
| SMILES | COc1cccc(-c2ccc3c(c2)C(C)(C)CC3=NO)c1 |
| InChI | InChI=1S/C18H19NO2/c1-18(2)11-17(19-20)15-8-7-13(10-16(15)18)12-5-4-6-14(9-12)21-3/h4-10,20H,11H2,1-3H3 |
| InChIKey | MZDYALFVUKOIPJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|