C23H24N2O2 — CID 58198287
[1'-hydroxy-6-(3-methoxyphenyl)-1'-methylspiro[3H-indene-2,4'-cyclohexane]-1-ylidene]cyanamide (PubChem CID 58198287) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [1'-hydroxy-6-(3-methoxyphenyl)-1'-methylspiro[3H-indene-2,4'-cyclohexane]-1-ylidene]cyanamide.
| Compound Name | [1'-hydroxy-6-(3-methoxyphenyl)-1'-methylspiro[3H-indene-2,4'-cyclohexane]-1-ylidene]cyanamide |
|---|---|
| PubChem CID | 58198287 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [1'-hydroxy-6-(3-methoxyphenyl)-1'-methylspiro[3H-indene-2,4'-cyclohexane]-1-ylidene]cyanamide |
| SMILES | COc1cccc(-c2ccc3c(c2)/C(=N\C#N)C2(CCC(C)(O)CC2)C3)c1 |
| InChI | InChI=1S/C23H24N2O2/c1-22(26)8-10-23(11-9-22)14-18-7-6-17(13-20(18)21(23)25-15-24)16-4-3-5-19(12-16)27-2/h3-7,12-13,26H,8-11,14H2,1-2H3/b25-21+ |
| InChIKey | NMUKHRHGBPXGPT-NJNXFGOHSA-N |
| XLogP | 4.50 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|