C19H24N2O — CID 58197513
(4'-methoxy-6-propan-2-ylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide (PubChem CID 58197513) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (4'-methoxy-6-propan-2-ylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide.
| Compound Name | (4'-methoxy-6-propan-2-ylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
|---|---|
| PubChem CID | 58197513 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (4'-methoxy-6-propan-2-ylspiro[3H-indene-2,1'-cyclohexane]-1-ylidene)cyanamide |
| SMILES | COC1CCC2(CC1)Cc1ccc(C(C)C)cc1/C2=N\C#N |
| InChI | InChI=1S/C19H24N2O/c1-13(2)14-4-5-15-11-19(8-6-16(22-3)7-9-19)18(21-12-20)17(15)10-14/h4-5,10,13,16H,6-9,11H2,1-3H3/b21-18+ |
| InChIKey | NVKDCLNTOIZSFT-DYTRJAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|