C12H20N2O4S — CID 173159447
1,3-bis(prop-2-enyl)-2H-imidazole;prop-2-enyl hydrogen sulfate (PubChem CID 173159447) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-2H-imidazole;prop-2-enyl hydrogen sulfate.
| Compound Name | 1,3-bis(prop-2-enyl)-2H-imidazole;prop-2-enyl hydrogen sulfate |
|---|---|
| PubChem CID | 173159447 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-2H-imidazole;prop-2-enyl hydrogen sulfate |
| SMILES | C=CCN1C=CN(CC=C)C1.C=CCOS(=O)(=O)O |
| InChI | InChI=1S/C9H14N2.C3H6O4S/c1-3-5-10-7-8-11(9-10)6-4-2;1-2-3-7-8(4,5)6/h3-4,7-8H,1-2,5-6,9H2;2H,1,3H2,(H,4,5,6) |
| InChIKey | KNMTXLVTKHWESA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|