C22H20AsF3N4O3S — CID 173168705
1-[benzyl(ethyl)arsanyl]-N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]formamide;2,2,2-trifluoroacetic acid (PubChem CID 173168705) has the molecular formula C22H20AsF3N4O3S and a molecular weight of 552.41 g/mol. Its IUPAC name is 1-[benzyl(ethyl)arsanyl]-N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]formamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[benzyl(ethyl)arsanyl]-N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]formamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 173168705 |
| Molecular Formula | C22H20AsF3N4O3S |
| Molecular Weight | 552.41 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 1-[benzyl(ethyl)arsanyl]-N-[2-(1,3-thiazol-4-yl)-3H-benzimidazol-5-yl]formamide;2,2,2-trifluoroacetic acid |
| SMILES | CC[As](Cc1ccccc1)C(=O)Nc1ccc2nc(-c3cscn3)[nH]c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H19AsN4OS.C2HF3O2/c1-2-21(11-14-6-4-3-5-7-14)20(26)23-15-8-9-16-17(10-15)25-19(24-16)18-12-27-13-22-18;3-2(4,5)1(6)7/h3-10,12-13H,2,11H2,1H3,(H,23,26)(H,24,25);(H,6,7) |
| InChIKey | DYUADLOHLLOSOC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|