C17H12ClN3O2S2 — CID 52935144
4-[6-[(2-chlorophenyl)methylsulfonyl]-1H-benzimidazol-2-yl]-1,3-thiazole (PubChem CID 52935144) has the molecular formula C17H12ClN3O2S2 and a molecular weight of 389.89 g/mol. Its IUPAC name is 4-[6-[(2-chlorophenyl)methylsulfonyl]-1H-benzimidazol-2-yl]-1,3-thiazole.
| Compound Name | 4-[6-[(2-chlorophenyl)methylsulfonyl]-1H-benzimidazol-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 52935144 |
| Molecular Formula | C17H12ClN3O2S2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 4-[6-[(2-chlorophenyl)methylsulfonyl]-1H-benzimidazol-2-yl]-1,3-thiazole |
| SMILES | O=S(=O)(Cc1ccccc1Cl)c1ccc2nc(-c3cscn3)[nH]c2c1 |
| InChI | InChI=1S/C17H12ClN3O2S2/c18-13-4-2-1-3-11(13)9-25(22,23)12-5-6-14-15(7-12)21-17(20-14)16-8-24-10-19-16/h1-8,10H,9H2,(H,20,21) |
| InChIKey | KCIFJKBKERJIGB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |