C15H13N3S2 — CID 118107792
4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran (PubChem CID 118107792) has the molecular formula C15H13N3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran |
|---|---|
| PubChem CID | 118107792 |
| Molecular Formula | C15H13N3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran |
| SMILES | C1=CCSC=C1.c1ccc2[nH]c(-c3cscn3)nc2c1 |
| InChI | InChI=1S/C10H7N3S.C5H6S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9;1-2-4-6-5-3-1/h1-6H,(H,12,13);1-4H,5H2 |
| InChIKey | UDYAROTYPVCAMN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |