About 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran
4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran (PubChem CID 118107792) has the molecular formula C15H13N3S2
and a molecular weight of 299.42 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran.
Molecular Properties
| Compound Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran |
| PubChem CID | 118107792 |
| Molecular Formula | C15H13N3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran |
| SMILES | C1=CCSC=C1.c1ccc2[nH]c(-c3cscn3)nc2c1 |
| InChI | InChI=1S/C10H7N3S.C5H6S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9;1-2-4-6-5-3-1/h1-6H,(H,12,13);1-4H,5H2 |
| InChIKey | UDYAROTYPVCAMN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran?
The IUPAC name of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran (CID 118107792) is 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran.
What is the SMILES notation for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran?
The canonical SMILES for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran is C1=CCSC=C1.c1ccc2[nH]c(-c3cscn3)nc2c1.
What is the InChIKey of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran?
The InChIKey is UDYAROTYPVCAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3S.C5H6S/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9;1-2-4-6-5-3-1/h1-6H,(H,12,13);1-4H,5H2.
What are the key properties of 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran?
4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran has a molecular weight of 299.42 g/mol, XLogP of 4.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-benzimidazol-2-yl)-1,3-thiazole;2H-thiopyran is sourced from PubChem (CID 118107792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).