About lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride
lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride (PubChem CID 173171316) has the molecular formula C10H23LiN2
and a molecular weight of 178.25 g/mol. Its IUPAC name is lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride.
Molecular Properties
| Compound Name | lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride |
| PubChem CID | 173171316 |
| Molecular Formula | C10H23LiN2 |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.20 |
| IUPAC Name | lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride |
| SMILES | CC(C)(C)N/C=C/NC(C)(C)C.[H-].[Li+] |
| InChI | InChI=1S/C10H22N2.Li.H/c1-9(2,3)11-7-8-12-10(4,5)6;;/h7-8,11-12H,1-6H3;;/q;+1;-1/b8-7+;; |
| InChIKey | CAUNRQZNYYEBFG-MIIBGCIDSA-N |
| XLogP | -0.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride?
The IUPAC name of lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride (CID 173171316) is lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride.
What is the SMILES notation for lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride?
The canonical SMILES for lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride is CC(C)(C)N/C=C/NC(C)(C)C.[H-].[Li+].
What is the InChIKey of lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride?
The InChIKey is CAUNRQZNYYEBFG-MIIBGCIDSA-N. The full InChI is InChI=1S/C10H22N2.Li.H/c1-9(2,3)11-7-8-12-10(4,5)6;;/h7-8,11-12H,1-6H3;;/q;+1;-1/b8-7+;;.
What are the key properties of lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride?
lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride has a molecular weight of 178.25 g/mol, XLogP of -0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;(E)-N,N'-ditert-butylethene-1,2-diamine;hydride is sourced from PubChem (CID 173171316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).