About 2-ethylhexylcarbamic acid;octan-3-amine
2-ethylhexylcarbamic acid;octan-3-amine (PubChem CID 173173211) has the molecular formula C17H38N2O2
and a molecular weight of 302.50 g/mol. Its IUPAC name is 2-ethylhexylcarbamic acid;octan-3-amine.
Molecular Properties
| Compound Name | 2-ethylhexylcarbamic acid;octan-3-amine |
| PubChem CID | 173173211 |
| Molecular Formula | C17H38N2O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | 2-ethylhexylcarbamic acid;octan-3-amine |
| SMILES | CCCCC(CC)CNC(=O)O.CCCCCC(N)CC |
| InChI | InChI=1S/C9H19NO2.C8H19N/c1-3-5-6-8(4-2)7-10-9(11)12;1-3-5-6-7-8(9)4-2/h8,10H,3-7H2,1-2H3,(H,11,12);8H,3-7,9H2,1-2H3 |
| InChIKey | LARDCMFQDCPTKK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexylcarbamic acid;octan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexylcarbamic acid;octan-3-amine?
The IUPAC name of 2-ethylhexylcarbamic acid;octan-3-amine (CID 173173211) is 2-ethylhexylcarbamic acid;octan-3-amine.
What is the SMILES notation for 2-ethylhexylcarbamic acid;octan-3-amine?
The canonical SMILES for 2-ethylhexylcarbamic acid;octan-3-amine is CCCCC(CC)CNC(=O)O.CCCCCC(N)CC.
What is the InChIKey of 2-ethylhexylcarbamic acid;octan-3-amine?
The InChIKey is LARDCMFQDCPTKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.C8H19N/c1-3-5-6-8(4-2)7-10-9(11)12;1-3-5-6-7-8(9)4-2/h8,10H,3-7H2,1-2H3,(H,11,12);8H,3-7,9H2,1-2H3.
What are the key properties of 2-ethylhexylcarbamic acid;octan-3-amine?
2-ethylhexylcarbamic acid;octan-3-amine has a molecular weight of 302.50 g/mol, XLogP of 4.77, 11 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexylcarbamic acid;octan-3-amine is sourced from PubChem (CID 173173211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).