About ethyl N-ethenylsilylcarbamate
ethyl N-ethenylsilylcarbamate (PubChem CID 173181383) has the molecular formula C5H11NO2Si
and a molecular weight of 145.23 g/mol. Its IUPAC name is ethyl N-ethenylsilylcarbamate.
Molecular Properties
| Compound Name | ethyl N-ethenylsilylcarbamate |
| PubChem CID | 173181383 |
| Molecular Formula | C5H11NO2Si |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | ethyl N-ethenylsilylcarbamate |
| SMILES | C=C[SiH2]NC(=O)OCC |
| InChI | InChI=1S/C5H11NO2Si/c1-3-8-5(7)6-9-4-2/h4H,2-3,9H2,1H3,(H,6,7) |
| InChIKey | KCVUITPCOXCCCB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-ethenylsilylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-ethenylsilylcarbamate?
The IUPAC name of ethyl N-ethenylsilylcarbamate (CID 173181383) is ethyl N-ethenylsilylcarbamate.
What is the SMILES notation for ethyl N-ethenylsilylcarbamate?
The canonical SMILES for ethyl N-ethenylsilylcarbamate is C=C[SiH2]NC(=O)OCC.
What is the InChIKey of ethyl N-ethenylsilylcarbamate?
The InChIKey is KCVUITPCOXCCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2Si/c1-3-8-5(7)6-9-4-2/h4H,2-3,9H2,1H3,(H,6,7).
What are the key properties of ethyl N-ethenylsilylcarbamate?
ethyl N-ethenylsilylcarbamate has a molecular weight of 145.23 g/mol, XLogP of -0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-ethenylsilylcarbamate is sourced from PubChem (CID 173181383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).