C8H22N2OSi — CID 173182182
N'-[propan-2-yloxy(propyl)silyl]ethane-1,2-diamine (PubChem CID 173182182) has the molecular formula C8H22N2OSi and a molecular weight of 190.36 g/mol. Its IUPAC name is N'-[propan-2-yloxy(propyl)silyl]ethane-1,2-diamine.
| Compound Name | N'-[propan-2-yloxy(propyl)silyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 173182182 |
| Molecular Formula | C8H22N2OSi |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N'-[propan-2-yloxy(propyl)silyl]ethane-1,2-diamine |
| SMILES | CCC[SiH](NCCN)OC(C)C |
| InChI | InChI=1S/C8H22N2OSi/c1-4-7-12(10-6-5-9)11-8(2)3/h8,10,12H,4-7,9H2,1-3H3 |
| InChIKey | FQZGPAHSTNAUFD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|