C19H18ClFN2O2 — CID 173183970
4-(2-chloro-3-fluorocyclohexa-1,3-dien-1-yl)-6,7-dimethoxy-5-prop-2-enylquinazoline (PubChem CID 173183970) has the molecular formula C19H18ClFN2O2 and a molecular weight of 360.82 g/mol. Its IUPAC name is 4-(2-chloro-3-fluorocyclohexa-1,3-dien-1-yl)-6,7-dimethoxy-5-prop-2-enylquinazoline.
| Compound Name | 4-(2-chloro-3-fluorocyclohexa-1,3-dien-1-yl)-6,7-dimethoxy-5-prop-2-enylquinazoline |
|---|---|
| PubChem CID | 173183970 |
| Molecular Formula | C19H18ClFN2O2 |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 4-(2-chloro-3-fluorocyclohexa-1,3-dien-1-yl)-6,7-dimethoxy-5-prop-2-enylquinazoline |
| SMILES | C=CCc1c(OC)c(OC)cc2ncnc(C3=C(Cl)C(F)=CCC3)c12 |
| InChI | InChI=1S/C19H18ClFN2O2/c1-4-6-11-16-14(9-15(24-2)19(11)25-3)22-10-23-18(16)12-7-5-8-13(21)17(12)20/h4,8-10H,1,5-7H2,2-3H3 |
| InChIKey | CEHQEBFWNOMEKR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|