C20H17NSi — CID 173184647
8-cyclopenta-1,3-dien-1-yl-2,2-dimethyl-4-phenyl-5-aza-2-silatricyclo[4.2.1.03,9]nona-1(9),3,5,7-tetraene (PubChem CID 173184647) has the molecular formula C20H17NSi and a molecular weight of 299.45 g/mol. Its IUPAC name is 8-cyclopenta-1,3-dien-1-yl-2,2-dimethyl-4-phenyl-5-aza-2-silatricyclo[4.2.1.03,9]nona-1(9),3,5,7-tetraene.
| Compound Name | 8-cyclopenta-1,3-dien-1-yl-2,2-dimethyl-4-phenyl-5-aza-2-silatricyclo[4.2.1.03,9]nona-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 173184647 |
| Molecular Formula | C20H17NSi |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 8-cyclopenta-1,3-dien-1-yl-2,2-dimethyl-4-phenyl-5-aza-2-silatricyclo[4.2.1.03,9]nona-1(9),3,5,7-tetraene |
| SMILES | C[Si]1(C)C2=C3C(=NC(c4ccccc4)=C31)C=C2C1=CC=CC1 |
| InChI | InChI=1S/C20H17NSi/c1-22(2)19-15(13-8-6-7-9-13)12-16-17(19)20(22)18(21-16)14-10-4-3-5-11-14/h3-8,10-12H,9H2,1-2H3 |
| InChIKey | WIJHAFNSJCBLBG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|