C21H31N — CID 145409324
ethane;(3Z,5Z)-3-methyl-N-[(Z)-1-phenylprop-1-enyl]nona-3,5-dien-2-imine (PubChem CID 145409324) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is ethane;(3Z,5Z)-3-methyl-N-[(Z)-1-phenylprop-1-enyl]nona-3,5-dien-2-imine.
| Compound Name | ethane;(3Z,5Z)-3-methyl-N-[(Z)-1-phenylprop-1-enyl]nona-3,5-dien-2-imine |
|---|---|
| PubChem CID | 145409324 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | ethane;(3Z,5Z)-3-methyl-N-[(Z)-1-phenylprop-1-enyl]nona-3,5-dien-2-imine |
| SMILES | C/C=C(\N=C(C)\C(C)=C/C=C\CCC)c1ccccc1.CC |
| InChI | InChI=1S/C19H25N.C2H6/c1-5-7-8-10-13-16(3)17(4)20-19(6-2)18-14-11-9-12-15-18;1-2/h6,8-15H,5,7H2,1-4H3;1-2H3/b10-8-,16-13-,19-6-,20-17+; |
| InChIKey | XFSOBFXVENODRD-WIQARJOPSA-N |
| XLogP | 6.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|