C23H27N3O6 — CID 173184918
2-methylpropyl 2-[4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetate (PubChem CID 173184918) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-methylpropyl 2-[4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetate.
| Compound Name | 2-methylpropyl 2-[4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
|---|---|
| PubChem CID | 173184918 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-methylpropyl 2-[4-[2-[6-(N'-hydroxycarbamimidoyl)-7-oxo-6,7a-dihydro-1H-isoindol-2-yl]acetyl]phenoxy]acetate |
| SMILES | CC(C)COC(=O)COc1ccc(C(=O)CN2C=C3C=CC(C(N)=NO)C(=O)C3C2)cc1 |
| InChI | InChI=1S/C23H27N3O6/c1-14(2)12-32-21(28)13-31-17-6-3-15(4-7-17)20(27)11-26-9-16-5-8-18(23(24)25-30)22(29)19(16)10-26/h3-9,14,18-19,30H,10-13H2,1-2H3,(H2,24,25) |
| InChIKey | RGAPBAPEFYWAKY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|