About trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium
trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium (PubChem CID 173185324) has the molecular formula C10H27NO10Si
and a molecular weight of 349.41 g/mol. Its IUPAC name is trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium.
Molecular Properties
| Compound Name | trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium |
| PubChem CID | 173185324 |
| Molecular Formula | C10H27NO10Si |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium |
| SMILES | C[N+](OCCCO)(OCCCO)OCCCO.[O-][Si](O)(O)O |
| InChI | InChI=1S/C10H24NO6.H3O4Si/c1-11(15-8-2-5-12,16-9-3-6-13)17-10-4-7-14;1-5(2,3)4/h12-14H,2-10H2,1H3;1-3H/q+1;-1 |
| InChIKey | JFHAJQUIHWYNJQ-UHFFFAOYSA-N |
| XLogP | -3.87 |
| TPSA | 172.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | -3.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium?
The IUPAC name of trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium (CID 173185324) is trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium.
What is the SMILES notation for trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium?
The canonical SMILES for trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium is C[N+](OCCCO)(OCCCO)OCCCO.[O-][Si](O)(O)O.
What is the InChIKey of trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium?
The InChIKey is JFHAJQUIHWYNJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24NO6.H3O4Si/c1-11(15-8-2-5-12,16-9-3-6-13)17-10-4-7-14;1-5(2,3)4/h12-14H,2-10H2,1H3;1-3H/q+1;-1.
What are the key properties of trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium?
trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium has a molecular weight of 349.41 g/mol, XLogP of -3.87, 12 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for trihydroxy(oxido)silane;tris(3-hydroxypropoxy)-methylazanium is sourced from PubChem (CID 173185324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).