C11H20N2O4 — CID 173185703
3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid (PubChem CID 173185703) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid.
| Compound Name | 3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid |
|---|---|
| PubChem CID | 173185703 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 3-amino-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoic acid |
| SMILES | CCC(NC(=O)OC(C)(C)C)C(N)=CC(=O)O |
| InChI | InChI=1S/C11H20N2O4/c1-5-8(7(12)6-9(14)15)13-10(16)17-11(2,3)4/h6,8H,5,12H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | LJOXLAWPKBJDPW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|