C24H34N3O3+ — CID 173186221
(E,4E)-4-[(4-methoxyphenyl)methylidene]-1-[1-(piperazine-1-carbonyl)piperidin-1-ium-1-yl]hex-2-en-1-one (PubChem CID 173186221) has the molecular formula C24H34N3O3+ and a molecular weight of 412.55 g/mol. Its IUPAC name is (E,4E)-4-[(4-methoxyphenyl)methylidene]-1-[1-(piperazine-1-carbonyl)piperidin-1-ium-1-yl]hex-2-en-1-one.
| Compound Name | (E,4E)-4-[(4-methoxyphenyl)methylidene]-1-[1-(piperazine-1-carbonyl)piperidin-1-ium-1-yl]hex-2-en-1-one |
|---|---|
| PubChem CID | 173186221 |
| Molecular Formula | C24H34N3O3+ |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (E,4E)-4-[(4-methoxyphenyl)methylidene]-1-[1-(piperazine-1-carbonyl)piperidin-1-ium-1-yl]hex-2-en-1-one |
| SMILES | CCC(/C=C/C(=O)[N+]1(C(=O)N2CCNCC2)CCCCC1)=C\c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H34N3O3/c1-3-20(19-21-7-10-22(30-2)11-8-21)9-12-23(28)27(17-5-4-6-18-27)24(29)26-15-13-25-14-16-26/h7-12,19,25H,3-6,13-18H2,1-2H3/q+1/b12-9+,20-19+ |
| InChIKey | QZJZYFKJNYRZCI-NKLQRROOSA-N |
| XLogP | 3.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|