C20H30N6S — CID 173186259
4-N,4-N-diethyl-1-N-(2-ethylsulfanyl-6-piperazin-1-ylpyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 173186259) has the molecular formula C20H30N6S and a molecular weight of 386.57 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(2-ethylsulfanyl-6-piperazin-1-ylpyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-(2-ethylsulfanyl-6-piperazin-1-ylpyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 173186259 |
| Molecular Formula | C20H30N6S |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(2-ethylsulfanyl-6-piperazin-1-ylpyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | CCSc1nc(Nc2ccc(N(CC)CC)cc2)cc(N2CCNCC2)n1 |
| InChI | InChI=1S/C20H30N6S/c1-4-25(5-2)17-9-7-16(8-10-17)22-18-15-19(24-20(23-18)27-6-3)26-13-11-21-12-14-26/h7-10,15,21H,4-6,11-14H2,1-3H3,(H,22,23,24) |
| InChIKey | MCKKWVGPWHKYMN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|