C10H8AsNO2 — CID 173186546
1-arsanyl-3-phenylpyrrole-2,5-dione (PubChem CID 173186546) has the molecular formula C10H8AsNO2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 1-arsanyl-3-phenylpyrrole-2,5-dione.
| Compound Name | 1-arsanyl-3-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 173186546 |
| Molecular Formula | C10H8AsNO2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 1-arsanyl-3-phenylpyrrole-2,5-dione |
| SMILES | O=C1C=C(c2ccccc2)C(=O)N1[AsH2] |
| InChI | InChI=1S/C10H8AsNO2/c11-12-9(13)6-8(10(12)14)7-4-2-1-3-5-7/h1-6H,11H2 |
| InChIKey | VDPYJOXMPVFPOU-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|