4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid

C15H16N2O4 — CID 18442738

IUPAC4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid
SMILESO=C(O)NCCCCN1C(=O)C=C(c2ccccc2)C1=O
InChIInChI=1S/C15H16N2O4/c18-13-10-12(11-6-2-1-3-7-11)14(19)17(13)9-5-4-8-16-15(20)21/h1-3,6-7,10,16H,4-5,8-9H2,(H,20,21)
InChIKeyYSKLNQPXDZYDME-UHFFFAOYSA-N
MW288.30 g/mol
LogP1.49
Rot. Bonds6

About 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid

4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid (PubChem CID 18442738) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid.

Molecular Properties

Compound Name4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid
PubChem CID18442738
Molecular FormulaC15H16N2O4
Molecular Weight288.30 g/mol
Exact Mass288.11
IUPAC Name4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid
SMILESO=C(O)NCCCCN1C(=O)C=C(c2ccccc2)C1=O
InChIInChI=1S/C15H16N2O4/c18-13-10-12(11-6-2-1-3-7-11)14(19)17(13)9-5-4-8-16-15(20)21/h1-3,6-7,10,16H,4-5,8-9H2,(H,20,21)
InChIKeyYSKLNQPXDZYDME-UHFFFAOYSA-N
XLogP1.49
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.30
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid?
The IUPAC name of 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid (CID 18442738) is 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid.
What is the SMILES notation for 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid?
The canonical SMILES for 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid is O=C(O)NCCCCN1C(=O)C=C(c2ccccc2)C1=O.
What is the InChIKey of 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid?
The InChIKey is YSKLNQPXDZYDME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O4/c18-13-10-12(11-6-2-1-3-7-11)14(19)17(13)9-5-4-8-16-15(20)21/h1-3,6-7,10,16H,4-5,8-9H2,(H,20,21).
What are the key properties of 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid?
4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid has a molecular weight of 288.30 g/mol, XLogP of 1.49, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid is sourced from PubChem (CID 18442738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).