C15H16N2O4 — CID 18442738
4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid (PubChem CID 18442738) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid.
| Compound Name | 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid |
|---|---|
| PubChem CID | 18442738 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-(2,5-dioxo-3-phenylpyrrol-1-yl)butylcarbamic acid |
| SMILES | O=C(O)NCCCCN1C(=O)C=C(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N2O4/c18-13-10-12(11-6-2-1-3-7-11)14(19)17(13)9-5-4-8-16-15(20)21/h1-3,6-7,10,16H,4-5,8-9H2,(H,20,21) |
| InChIKey | YSKLNQPXDZYDME-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|