C24H35NO2 — CID 173190847
2-[3-(2,5-dimethylhexan-3-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine (PubChem CID 173190847) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-[3-(2,5-dimethylhexan-3-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[3-(2,5-dimethylhexan-3-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 173190847 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | 2-[3-(2,5-dimethylhexan-3-yl)phenoxy]-N-[(4-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccc(CNCCOc2cccc(C(CC(C)C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C24H35NO2/c1-18(2)15-24(19(3)4)21-7-6-8-23(16-21)27-14-13-25-17-20-9-11-22(26-5)12-10-20/h6-12,16,18-19,24-25H,13-15,17H2,1-5H3 |
| InChIKey | XINZDVSKQACZMO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|