C17H25MgNO5 — CID 173191029
magnesium;formamidomethyl 1-[(4-methoxyphenyl)methoxy]cyclohexane-1-carboxylate;hydride (PubChem CID 173191029) has the molecular formula C17H25MgNO5 and a molecular weight of 347.69 g/mol. Its IUPAC name is magnesium;formamidomethyl 1-[(4-methoxyphenyl)methoxy]cyclohexane-1-carboxylate;hydride.
| Compound Name | magnesium;formamidomethyl 1-[(4-methoxyphenyl)methoxy]cyclohexane-1-carboxylate;hydride |
|---|---|
| PubChem CID | 173191029 |
| Molecular Formula | C17H25MgNO5 |
| Molecular Weight | 347.69 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | magnesium;formamidomethyl 1-[(4-methoxyphenyl)methoxy]cyclohexane-1-carboxylate;hydride |
| SMILES | COc1ccc(COC2(C(=O)OCNC=O)CCCCC2)cc1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C17H23NO5.Mg.2H/c1-21-15-7-5-14(6-8-15)11-23-17(9-3-2-4-10-17)16(20)22-13-18-12-19;;;/h5-8,12H,2-4,9-11,13H2,1H3,(H,18,19);;;/q;+2;2*-1 |
| InChIKey | RDIWRNPUBQBTGR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.69 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|