About potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride
potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride (PubChem CID 173196812) has the molecular formula C12H19KO3S2
and a molecular weight of 314.51 g/mol. Its IUPAC name is potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride.
Molecular Properties
| Compound Name | potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride |
| PubChem CID | 173196812 |
| Molecular Formula | C12H19KO3S2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride |
| SMILES | CC(=O)SCC(C(=O)OC(C)=S)C1CCCC1.[H-].[K+] |
| InChI | InChI=1S/C12H18O3S2.K.H/c1-8(13)17-7-11(10-5-3-4-6-10)12(14)15-9(2)16;;/h10-11H,3-7H2,1-2H3;;/q;+1;-1 |
| InChIKey | RJUARBFXLCPXPI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride?
The IUPAC name of potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride (CID 173196812) is potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride.
What is the SMILES notation for potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride?
The canonical SMILES for potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride is CC(=O)SCC(C(=O)OC(C)=S)C1CCCC1.[H-].[K+].
What is the InChIKey of potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride?
The InChIKey is RJUARBFXLCPXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S2.K.H/c1-8(13)17-7-11(10-5-3-4-6-10)12(14)15-9(2)16;;/h10-11H,3-7H2,1-2H3;;/q;+1;-1.
What are the key properties of potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride?
potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride has a molecular weight of 314.51 g/mol, XLogP of 0.08, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethanethioyl 3-acetylsulfanyl-2-cyclopentylpropanoate;hydride is sourced from PubChem (CID 173196812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).