C25H26ClFN2O3 — CID 173197138
2-[[1-[4-(4-fluorophenyl)piperidin-3-yl]-2-naphthalen-2-ylethylidene]amino]oxyacetic acid;hydrochloride (PubChem CID 173197138) has the molecular formula C25H26ClFN2O3 and a molecular weight of 456.95 g/mol. Its IUPAC name is 2-[[1-[4-(4-fluorophenyl)piperidin-3-yl]-2-naphthalen-2-ylethylidene]amino]oxyacetic acid;hydrochloride.
| Compound Name | 2-[[1-[4-(4-fluorophenyl)piperidin-3-yl]-2-naphthalen-2-ylethylidene]amino]oxyacetic acid;hydrochloride |
|---|---|
| PubChem CID | 173197138 |
| Molecular Formula | C25H26ClFN2O3 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[[1-[4-(4-fluorophenyl)piperidin-3-yl]-2-naphthalen-2-ylethylidene]amino]oxyacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CON=C(Cc1ccc2ccccc2c1)C1CNCCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H25FN2O3.ClH/c26-21-9-7-19(8-10-21)22-11-12-27-15-23(22)24(28-31-16-25(29)30)14-17-5-6-18-3-1-2-4-20(18)13-17;/h1-10,13,22-23,27H,11-12,14-16H2,(H,29,30);1H |
| InChIKey | SDIQLMKPWOSYKT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|