About 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene
1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene (PubChem CID 173197399) has the molecular formula C23H18Cl2O
and a molecular weight of 381.30 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene.
Molecular Properties
| Compound Name | 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene |
| PubChem CID | 173197399 |
| Molecular Formula | C23H18Cl2O |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene |
| SMILES | COc1ccc(-c2ccccc2C2=C(Cl)C(Cl)=CCC2)c2ccccc12 |
| InChI | InChI=1S/C23H18Cl2O/c1-26-22-14-13-18(16-8-4-5-10-19(16)22)15-7-2-3-9-17(15)20-11-6-12-21(24)23(20)25/h2-5,7-10,12-14H,6,11H2,1H3 |
| InChIKey | PYGLJCPRGOQXIU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene?
The IUPAC name of 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene (CID 173197399) is 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene.
What is the SMILES notation for 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene?
The canonical SMILES for 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene is COc1ccc(-c2ccccc2C2=C(Cl)C(Cl)=CCC2)c2ccccc12.
What is the InChIKey of 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene?
The InChIKey is PYGLJCPRGOQXIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18Cl2O/c1-26-22-14-13-18(16-8-4-5-10-19(16)22)15-7-2-3-9-17(15)20-11-6-12-21(24)23(20)25/h2-5,7-10,12-14H,6,11H2,1H3.
What are the key properties of 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene?
1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene has a molecular weight of 381.30 g/mol, XLogP of 7.38, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,3-dichlorocyclohexa-1,3-dien-1-yl)phenyl]-4-methoxynaphthalene is sourced from PubChem (CID 173197399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).