C15H20N2O4 — CID 173197768
4-[(2R)-2-hydroxy-4-phenylbutanoyl]morpholine-3-carboxamide (PubChem CID 173197768) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxy-4-phenylbutanoyl]morpholine-3-carboxamide.
| Compound Name | 4-[(2R)-2-hydroxy-4-phenylbutanoyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 173197768 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-[(2R)-2-hydroxy-4-phenylbutanoyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1C(=O)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c16-14(19)12-10-21-9-8-17(12)15(20)13(18)7-6-11-4-2-1-3-5-11/h1-5,12-13,18H,6-10H2,(H2,16,19)/t12?,13-/m1/s1 |
| InChIKey | GFVGMDNGSAAGMU-ZGTCLIOFSA-N |
| XLogP | -0.31 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |