About [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane
[4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane (PubChem CID 173198637) has the molecular formula C15H28O2Si
and a molecular weight of 268.47 g/mol. Its IUPAC name is [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane.
Molecular Properties
| Compound Name | [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane |
| PubChem CID | 173198637 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane |
| SMILES | CCOC([SiH3])(CCCC1CC2C=CC1C2)OCC |
| InChI | InChI=1S/C15H28O2Si/c1-3-16-15(18,17-4-2)9-5-6-13-10-12-7-8-14(13)11-12/h7-8,12-14H,3-6,9-11H2,1-2,18H3 |
| InChIKey | OUBDTTYUIRVHKK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane?
The IUPAC name of [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane (CID 173198637) is [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane.
What is the SMILES notation for [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane?
The canonical SMILES for [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane is CCOC([SiH3])(CCCC1CC2C=CC1C2)OCC.
What is the InChIKey of [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane?
The InChIKey is OUBDTTYUIRVHKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2Si/c1-3-16-15(18,17-4-2)9-5-6-13-10-12-7-8-14(13)11-12/h7-8,12-14H,3-6,9-11H2,1-2,18H3.
What are the key properties of [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane?
[4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane has a molecular weight of 268.47 g/mol, XLogP of 2.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-bicyclo[2.2.1]hept-5-enyl)-1,1-diethoxybutyl]silane is sourced from PubChem (CID 173198637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).