C24H30 — CID 173200762
1-methyl-4-(6-phenylundeca-4,10-dien-3-yl)benzene (PubChem CID 173200762) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 1-methyl-4-(6-phenylundeca-4,10-dien-3-yl)benzene.
| Compound Name | 1-methyl-4-(6-phenylundeca-4,10-dien-3-yl)benzene |
|---|---|
| PubChem CID | 173200762 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 1-methyl-4-(6-phenylundeca-4,10-dien-3-yl)benzene |
| SMILES | C=CCCCC(C=CC(CC)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H30/c1-4-6-8-11-23(22-12-9-7-10-13-22)19-18-21(5-2)24-16-14-20(3)15-17-24/h4,7,9-10,12-19,21,23H,1,5-6,8,11H2,2-3H3 |
| InChIKey | RTOUVSAVDSJABG-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|