C4H10O5P+ — CID 173201044
methoxy-(2-methoxyethylperoxy)-oxophosphanium (PubChem CID 173201044) has the molecular formula C4H10O5P+ and a molecular weight of 169.09 g/mol. Its IUPAC name is methoxy-(2-methoxyethylperoxy)-oxophosphanium.
| Compound Name | methoxy-(2-methoxyethylperoxy)-oxophosphanium |
|---|---|
| PubChem CID | 173201044 |
| Molecular Formula | C4H10O5P+ |
| Molecular Weight | 169.09 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | methoxy-(2-methoxyethylperoxy)-oxophosphanium |
| SMILES | COCCOO[P+](=O)OC |
| InChI | InChI=1S/C4H10O5P/c1-6-3-4-8-9-10(5)7-2/h3-4H2,1-2H3/q+1 |
| InChIKey | GBFFDXKOCFLSJB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.09 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|