C20H17F3OS2 — CID 173201305
2-methyl-4-[[3-methyl-4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylsulfanyl]phenol (PubChem CID 173201305) has the molecular formula C20H17F3OS2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-methyl-4-[[3-methyl-4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylsulfanyl]phenol.
| Compound Name | 2-methyl-4-[[3-methyl-4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 173201305 |
| Molecular Formula | C20H17F3OS2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-methyl-4-[[3-methyl-4-[4-(trifluoromethyl)phenyl]thiophen-2-yl]methylsulfanyl]phenol |
| SMILES | Cc1cc(SCc2scc(-c3ccc(C(F)(F)F)cc3)c2C)ccc1O |
| InChI | InChI=1S/C20H17F3OS2/c1-12-9-16(7-8-18(12)24)25-11-19-13(2)17(10-26-19)14-3-5-15(6-4-14)20(21,22)23/h3-10,24H,11H2,1-2H3 |
| InChIKey | OYRVIOVKNHUYID-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |