C26H33N3O3 — CID 173202662
(E)-1-[2-[(dimethylamino)methyl]piperidin-1-yl]-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-en-1-one (PubChem CID 173202662) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is (E)-1-[2-[(dimethylamino)methyl]piperidin-1-yl]-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[2-[(dimethylamino)methyl]piperidin-1-yl]-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 173202662 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | (E)-1-[2-[(dimethylamino)methyl]piperidin-1-yl]-3-[3-nitro-2-(2-propan-2-ylphenyl)phenyl]prop-2-en-1-one |
| SMILES | CC(C)c1ccccc1-c1c(/C=C/C(=O)N2CCCCC2CN(C)C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H33N3O3/c1-19(2)22-12-5-6-13-23(22)26-20(10-9-14-24(26)29(31)32)15-16-25(30)28-17-8-7-11-21(28)18-27(3)4/h5-6,9-10,12-16,19,21H,7-8,11,17-18H2,1-4H3/b16-15+ |
| InChIKey | NYKLVIHLUMVUFF-FOCLMDBBSA-N |
| XLogP | 5.34 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|